C24H31N5O3 — CID 135500162
1-(6-aminohexyl)-3-(3-methoxyphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea (PubChem CID 135500162) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(6-aminohexyl)-3-(3-methoxyphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea.
| Compound Name | 1-(6-aminohexyl)-3-(3-methoxyphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 135500162 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-(6-aminohexyl)-3-(3-methoxyphenyl)-1-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]urea |
| SMILES | COc1cccc(NC(=O)N(CCCCCCN)C(C)c2nc3ccccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C24H31N5O3/c1-17(22-27-21-13-6-5-12-20(21)23(30)28-22)29(15-8-4-3-7-14-25)24(31)26-18-10-9-11-19(16-18)32-2/h5-6,9-13,16-17H,3-4,7-8,14-15,25H2,1-2H3,(H,26,31)(H,27,28,30) |
| InChIKey | ZKWLMENPBUATHH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|