C25H40N4O2 — CID 135533966
N-(6-aminohexyl)-3,5,5-trimethyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]hexanamide (PubChem CID 135533966) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-(6-aminohexyl)-3,5,5-trimethyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]hexanamide.
| Compound Name | N-(6-aminohexyl)-3,5,5-trimethyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 135533966 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-(6-aminohexyl)-3,5,5-trimethyl-N-[1-(4-oxo-3H-quinazolin-2-yl)ethyl]hexanamide |
| SMILES | CC(CC(=O)N(CCCCCCN)C(C)c1nc2ccccc2c(=O)[nH]1)CC(C)(C)C |
| InChI | InChI=1S/C25H40N4O2/c1-18(17-25(3,4)5)16-22(30)29(15-11-7-6-10-14-26)19(2)23-27-21-13-9-8-12-20(21)24(31)28-23/h8-9,12-13,18-19H,6-7,10-11,14-17,26H2,1-5H3,(H,27,28,31) |
| InChIKey | BPINHZRZSSGTRL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|