C25H33N4O2+ — CID 135622605
6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(3-phenylpropanoyl)amino]hexylazanium (PubChem CID 135622605) has the molecular formula C25H33N4O2+ and a molecular weight of 421.57 g/mol. Its IUPAC name is 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(3-phenylpropanoyl)amino]hexylazanium.
| Compound Name | 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(3-phenylpropanoyl)amino]hexylazanium |
|---|---|
| PubChem CID | 135622605 |
| Molecular Formula | C25H33N4O2+ |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(3-phenylpropanoyl)amino]hexylazanium |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N(CCCCCC[NH3+])C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C25H32N4O2/c1-19(24-27-22-14-8-7-13-21(22)25(31)28-24)29(18-10-3-2-9-17-26)23(30)16-15-20-11-5-4-6-12-20/h4-8,11-14,19H,2-3,9-10,15-18,26H2,1H3,(H,27,28,31)/p+1/t19-/m1/s1 |
| InChIKey | SPVSLEHQYPGYBW-LJQANCHMSA-O |
| XLogP | 3.25 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|