C25H30N4O2 — CID 135622575
(E)-N-(6-aminohexyl)-N-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 135622575) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-N-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(6-aminohexyl)-N-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135622575 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (E)-N-(6-aminohexyl)-N-[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H](c1nc2ccccc2c(=O)[nH]1)N(CCCCCCN)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H30N4O2/c1-19(24-27-22-14-8-7-13-21(22)25(31)28-24)29(18-10-3-2-9-17-26)23(30)16-15-20-11-5-4-6-12-20/h4-8,11-16,19H,2-3,9-10,17-18,26H2,1H3,(H,27,28,31)/b16-15+/t19-/m0/s1 |
| InChIKey | XPFQZDBFTOBWKJ-VVLLFNJHSA-N |
| XLogP | 4.05 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|