C24H28N2O2 — CID 141367752
(E)-N-(6-aminohexyl)-3-phenyl-N-[(E)-3-phenylprop-2-enoyl]prop-2-enamide (PubChem CID 141367752) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-3-phenyl-N-[(E)-3-phenylprop-2-enoyl]prop-2-enamide.
| Compound Name | (E)-N-(6-aminohexyl)-3-phenyl-N-[(E)-3-phenylprop-2-enoyl]prop-2-enamide |
|---|---|
| PubChem CID | 141367752 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (E)-N-(6-aminohexyl)-3-phenyl-N-[(E)-3-phenylprop-2-enoyl]prop-2-enamide |
| SMILES | NCCCCCCN(C(=O)/C=C/c1ccccc1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c25-19-9-1-2-10-20-26(23(27)17-15-21-11-5-3-6-12-21)24(28)18-16-22-13-7-4-8-14-22/h3-8,11-18H,1-2,9-10,19-20,25H2/b17-15+,18-16+ |
| InChIKey | BFEFJTMIKSVKNF-YTEMWHBBSA-N |
| XLogP | 4.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|