C24H31N4O3+ — CID 135772103
6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(2-phenoxyacetyl)amino]hexylazanium (PubChem CID 135772103) has the molecular formula C24H31N4O3+ and a molecular weight of 423.54 g/mol. Its IUPAC name is 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(2-phenoxyacetyl)amino]hexylazanium.
| Compound Name | 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(2-phenoxyacetyl)amino]hexylazanium |
|---|---|
| PubChem CID | 135772103 |
| Molecular Formula | C24H31N4O3+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 6-[[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl]-(2-phenoxyacetyl)amino]hexylazanium |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N(CCCCCC[NH3+])C(=O)COc1ccccc1 |
| InChI | InChI=1S/C24H30N4O3/c1-18(23-26-21-14-8-7-13-20(21)24(30)27-23)28(16-10-3-2-9-15-25)22(29)17-31-19-11-5-4-6-12-19/h4-8,11-14,18H,2-3,9-10,15-17,25H2,1H3,(H,26,27,30)/p+1/t18-/m1/s1 |
| InChIKey | VPHBCTUHBJKJNG-GOSISDBHSA-O |
| XLogP | 2.69 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|