C25H28N2O4 — CID 135816943
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-oxo-4-(4-pentylphenyl)butanoate (PubChem CID 135816943) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-oxo-4-(4-pentylphenyl)butanoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
|---|---|
| PubChem CID | 135816943 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 4-oxo-4-(4-pentylphenyl)butanoate |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)O[C@@H](C)c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-4-5-8-18-11-13-19(14-12-18)22(28)15-16-23(29)31-17(2)24-26-21-10-7-6-9-20(21)25(30)27-24/h6-7,9-14,17H,3-5,8,15-16H2,1-2H3,(H,26,27,30)/t17-/m0/s1 |
| InChIKey | DYUIMHCBKFGFST-KRWDZBQOSA-N |
| XLogP | 4.92 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|