C6H13NO3 — CID 123486151
6-methyloxazepane-4,5-diol (PubChem CID 123486151) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 6-methyloxazepane-4,5-diol.
| Compound Name | 6-methyloxazepane-4,5-diol |
|---|---|
| PubChem CID | 123486151 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 6-methyloxazepane-4,5-diol |
| SMILES | CC1CONCC(O)C1O |
| InChI | InChI=1S/C6H13NO3/c1-4-3-10-7-2-5(8)6(4)9/h4-9H,2-3H2,1H3 |
| InChIKey | DEUIHEMRRVQOBL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |