C6H13NO — CID 177019669
4,5-dimethyloxazinane (PubChem CID 177019669) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is 4,5-dimethyloxazinane.
| Compound Name | 4,5-dimethyloxazinane |
|---|---|
| PubChem CID | 177019669 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 4,5-dimethyloxazinane |
| SMILES | CC1CNOCC1C |
| InChI | InChI=1S/C6H13NO/c1-5-3-7-8-4-6(5)2/h5-7H,3-4H2,1-2H3 |
| InChIKey | FGSVCNASGUOYNB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |