C18H30 — CID 123486531
2-ethynyl-1,3,4-trimethyl-5-(2-methyl-2-propan-2-ylcyclopropyl)cyclohexane (PubChem CID 123486531) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-ethynyl-1,3,4-trimethyl-5-(2-methyl-2-propan-2-ylcyclopropyl)cyclohexane.
| Compound Name | 2-ethynyl-1,3,4-trimethyl-5-(2-methyl-2-propan-2-ylcyclopropyl)cyclohexane |
|---|---|
| PubChem CID | 123486531 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 2-ethynyl-1,3,4-trimethyl-5-(2-methyl-2-propan-2-ylcyclopropyl)cyclohexane |
| SMILES | C#CC1C(C)CC(C2CC2(C)C(C)C)C(C)C1C |
| InChI | InChI=1S/C18H30/c1-8-15-12(4)9-16(14(6)13(15)5)17-10-18(17,7)11(2)3/h1,11-17H,9-10H2,2-7H3 |
| InChIKey | GWEPBJGVMGNQLG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|