C17H30 — CID 91446725
1-(3,3-dimethylpent-4-ynyl)-1-methyl-2-propan-2-yl-3-propylcyclopropane (PubChem CID 91446725) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1-(3,3-dimethylpent-4-ynyl)-1-methyl-2-propan-2-yl-3-propylcyclopropane.
| Compound Name | 1-(3,3-dimethylpent-4-ynyl)-1-methyl-2-propan-2-yl-3-propylcyclopropane |
|---|---|
| PubChem CID | 91446725 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1-(3,3-dimethylpent-4-ynyl)-1-methyl-2-propan-2-yl-3-propylcyclopropane |
| SMILES | C#CC(C)(C)CCC1(C)C(CCC)C1C(C)C |
| InChI | InChI=1S/C17H30/c1-8-10-14-15(13(3)4)17(14,7)12-11-16(5,6)9-2/h2,13-15H,8,10-12H2,1,3-7H3 |
| InChIKey | LASDZQSWYWKTBT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|