C23H30 — CID 123486620
(2,4,4,5-tetramethyl-3-phenylhept-5-en-3-yl)benzene (PubChem CID 123486620) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is (2,4,4,5-tetramethyl-3-phenylhept-5-en-3-yl)benzene.
| Compound Name | (2,4,4,5-tetramethyl-3-phenylhept-5-en-3-yl)benzene |
|---|---|
| PubChem CID | 123486620 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (2,4,4,5-tetramethyl-3-phenylhept-5-en-3-yl)benzene |
| SMILES | CC=C(C)C(C)(C)C(c1ccccc1)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H30/c1-7-19(4)22(5,6)23(18(2)3,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h7-18H,1-6H3 |
| InChIKey | DDZKOUDFVBQWAY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|