C39H30N3O2+ — CID 123487877
2-[2-(1H-indol-3-yl)ethenyl]-3-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]-2-methylphenyl]-1-methylquinazolin-1-ium-4-one (PubChem CID 123487877) has the molecular formula C39H30N3O2+ and a molecular weight of 572.69 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethenyl]-3-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]-2-methylphenyl]-1-methylquinazolin-1-ium-4-one.
| Compound Name | 2-[2-(1H-indol-3-yl)ethenyl]-3-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]-2-methylphenyl]-1-methylquinazolin-1-ium-4-one |
|---|---|
| PubChem CID | 123487877 |
| Molecular Formula | C39H30N3O2+ |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethenyl]-3-[4-[2-(6-methoxynaphthalen-2-yl)ethynyl]-2-methylphenyl]-1-methylquinazolin-1-ium-4-one |
| SMILES | COc1ccc2cc(C#Cc3ccc(-n4c(C=Cc5c[nH]c6ccccc56)[n+](C)c5ccccc5c4=O)c(C)c3)ccc2c1 |
| InChI | InChI=1S/C39H29N3O2/c1-26-22-27(12-13-28-14-16-30-24-32(44-3)19-17-29(30)23-28)15-20-36(26)42-38(41(2)37-11-7-5-9-34(37)39(42)43)21-18-31-25-40-35-10-6-4-8-33(31)35/h4-11,14-25H,1-3H3/p+1 |
| InChIKey | PIFDPKWSFPHZIC-UHFFFAOYSA-O |
| XLogP | 7.34 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|