C25H26IN3 — CID 155540365
2-[(E)-2-(1H-indol-3-yl)ethenyl]-1-methyl-4-piperidin-1-ylquinolin-1-ium iodide (PubChem CID 155540365) has the molecular formula C25H26IN3 and a molecular weight of 495.41 g/mol. Its IUPAC name is 2-[(E)-2-(1H-indol-3-yl)ethenyl]-1-methyl-4-piperidin-1-ylquinolin-1-ium iodide.
| Compound Name | 2-[(E)-2-(1H-indol-3-yl)ethenyl]-1-methyl-4-piperidin-1-ylquinolin-1-ium iodide |
|---|---|
| PubChem CID | 155540365 |
| Molecular Formula | C25H26IN3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[(E)-2-(1H-indol-3-yl)ethenyl]-1-methyl-4-piperidin-1-ylquinolin-1-ium iodide |
| SMILES | C[n+]1c(/C=C/c2c[nH]c3ccccc23)cc(N2CCCCC2)c2ccccc21.[I-] |
| InChI | InChI=1S/C25H25N3.HI/c1-27-20(14-13-19-18-26-23-11-5-3-9-21(19)23)17-25(28-15-7-2-8-16-28)22-10-4-6-12-24(22)27;/h3-6,9-14,17-18H,2,7-8,15-16H2,1H3;1H |
| InChIKey | APHDXBHETMWGOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 22.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|