C27H31N4+ — CID 174240183
2-[2-(1H-indol-3-yl)ethenyl]-1-methyl-N-(2-piperidin-1-ylethyl)quinolin-1-ium-4-amine (PubChem CID 174240183) has the molecular formula C27H31N4+ and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethenyl]-1-methyl-N-(2-piperidin-1-ylethyl)quinolin-1-ium-4-amine.
| Compound Name | 2-[2-(1H-indol-3-yl)ethenyl]-1-methyl-N-(2-piperidin-1-ylethyl)quinolin-1-ium-4-amine |
|---|---|
| PubChem CID | 174240183 |
| Molecular Formula | C27H31N4+ |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethenyl]-1-methyl-N-(2-piperidin-1-ylethyl)quinolin-1-ium-4-amine |
| SMILES | C[n+]1c(C=Cc2c[nH]c3ccccc23)cc(NCCN2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C27H30N4/c1-30-22(14-13-21-20-29-25-11-5-3-9-23(21)25)19-26(24-10-4-6-12-27(24)30)28-15-18-31-16-7-2-8-17-31/h3-6,9-14,19-20H,2,7-8,15-18H2,1H3,(H,28,29)/p+1 |
| InChIKey | SEZXFEQMNFMVPH-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 34.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|