C20H46O2Si2 — CID 123487885
2,6-dimethylheptan-3-yloxy-[2-(2,6-dimethylheptan-3-yloxysilyl)ethyl]silane (PubChem CID 123487885) has the molecular formula C20H46O2Si2 and a molecular weight of 374.76 g/mol. Its IUPAC name is 2,6-dimethylheptan-3-yloxy-[2-(2,6-dimethylheptan-3-yloxysilyl)ethyl]silane.
| Compound Name | 2,6-dimethylheptan-3-yloxy-[2-(2,6-dimethylheptan-3-yloxysilyl)ethyl]silane |
|---|---|
| PubChem CID | 123487885 |
| Molecular Formula | C20H46O2Si2 |
| Molecular Weight | 374.76 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 2,6-dimethylheptan-3-yloxy-[2-(2,6-dimethylheptan-3-yloxysilyl)ethyl]silane |
| SMILES | CC(C)CCC(O[SiH2]CC[SiH2]OC(CCC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C20H46O2Si2/c1-15(2)9-11-19(17(5)6)21-23-13-14-24-22-20(18(7)8)12-10-16(3)4/h15-20H,9-14,23-24H2,1-8H3 |
| InChIKey | RTQOWRGTKMYYDT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|