C8H21NOSi — CID 175065172
N,N-dimethyl-3-propan-2-yloxysilylpropan-1-amine (PubChem CID 175065172) has the molecular formula C8H21NOSi and a molecular weight of 175.35 g/mol. Its IUPAC name is N,N-dimethyl-3-propan-2-yloxysilylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-propan-2-yloxysilylpropan-1-amine |
|---|---|
| PubChem CID | 175065172 |
| Molecular Formula | C8H21NOSi |
| Molecular Weight | 175.35 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,N-dimethyl-3-propan-2-yloxysilylpropan-1-amine |
| SMILES | CC(C)O[SiH2]CCCN(C)C |
| InChI | InChI=1S/C8H21NOSi/c1-8(2)10-11-7-5-6-9(3)4/h8H,5-7,11H2,1-4H3 |
| InChIKey | AMVIUUOTGBTSAU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|