C8H24N2Si2 — CID 175971419
N,N-dimethyl-3-(trimethylsilylamino)silylpropan-1-amine (PubChem CID 175971419) has the molecular formula C8H24N2Si2 and a molecular weight of 204.47 g/mol. Its IUPAC name is N,N-dimethyl-3-(trimethylsilylamino)silylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-(trimethylsilylamino)silylpropan-1-amine |
|---|---|
| PubChem CID | 175971419 |
| Molecular Formula | C8H24N2Si2 |
| Molecular Weight | 204.47 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | N,N-dimethyl-3-(trimethylsilylamino)silylpropan-1-amine |
| SMILES | CN(C)CCC[SiH2]N[Si](C)(C)C |
| InChI | InChI=1S/C8H24N2Si2/c1-10(2)7-6-8-11-9-12(3,4)5/h9H,6-8,11H2,1-5H3 |
| InChIKey | HYEBVHNMBIRISV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|