C9H26N2Si2 — CID 151482852
3-[(dimethylsilylamino)-dimethylsilyl]-N,N-dimethylpropan-1-amine (PubChem CID 151482852) has the molecular formula C9H26N2Si2 and a molecular weight of 218.49 g/mol. Its IUPAC name is 3-[(dimethylsilylamino)-dimethylsilyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(dimethylsilylamino)-dimethylsilyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 151482852 |
| Molecular Formula | C9H26N2Si2 |
| Molecular Weight | 218.49 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-[(dimethylsilylamino)-dimethylsilyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC[Si](C)(C)N[SiH](C)C |
| InChI | InChI=1S/C9H26N2Si2/c1-11(2)8-7-9-13(5,6)10-12(3)4/h10,12H,7-9H2,1-6H3 |
| InChIKey | PMVGDGGFDUVDIZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|