C14H37NO2Si3 — CID 158528204
3-[butyl-[dimethylsilyloxy(dimethyl)silyl]oxy-methylsilyl]-N,N-dimethylpropan-1-amine (PubChem CID 158528204) has the molecular formula C14H37NO2Si3 and a molecular weight of 335.71 g/mol. Its IUPAC name is 3-[butyl-[dimethylsilyloxy(dimethyl)silyl]oxy-methylsilyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[butyl-[dimethylsilyloxy(dimethyl)silyl]oxy-methylsilyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 158528204 |
| Molecular Formula | C14H37NO2Si3 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[butyl-[dimethylsilyloxy(dimethyl)silyl]oxy-methylsilyl]-N,N-dimethylpropan-1-amine |
| SMILES | CCCC[Si](C)(CCCN(C)C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C14H37NO2Si3/c1-9-10-13-20(8,14-11-12-15(2)3)17-19(6,7)16-18(4)5/h18H,9-14H2,1-8H3 |
| InChIKey | HUNMJQYFMAMDBP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|