C11H9BrF2N2O — CID 123488865
3-bromo-1-(2,4-difluorophenyl)-4-iminopiperidin-2-one (PubChem CID 123488865) has the molecular formula C11H9BrF2N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is 3-bromo-1-(2,4-difluorophenyl)-4-iminopiperidin-2-one.
| Compound Name | 3-bromo-1-(2,4-difluorophenyl)-4-iminopiperidin-2-one |
|---|---|
| PubChem CID | 123488865 |
| Molecular Formula | C11H9BrF2N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-bromo-1-(2,4-difluorophenyl)-4-iminopiperidin-2-one |
| SMILES | [H]/N=C1\CCN(c2ccc(F)cc2F)C(=O)C1Br |
| InChI | InChI=1S/C11H9BrF2N2O/c12-10-8(15)3-4-16(11(10)17)9-2-1-6(13)5-7(9)14/h1-2,5,10,15H,3-4H2/b15-8+ |
| InChIKey | WDKFNLZWJZKTCA-OVCLIPMQSA-N |
| XLogP | 2.48 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|