C20H27FN8O — CID 123489928
5-[(1R)-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-yl]-N-(2-ethoxy-5-fluoropyrimidin-4-yl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-amine (PubChem CID 123489928) has the molecular formula C20H27FN8O and a molecular weight of 414.49 g/mol. Its IUPAC name is 5-[(1R)-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-yl]-N-(2-ethoxy-5-fluoropyrimidin-4-yl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-amine.
| Compound Name | 5-[(1R)-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-yl]-N-(2-ethoxy-5-fluoropyrimidin-4-yl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 123489928 |
| Molecular Formula | C20H27FN8O |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 5-[(1R)-1,2,3,4,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-yl]-N-(2-ethoxy-5-fluoropyrimidin-4-yl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-amine |
| SMILES | CCOc1ncc(F)c(Nc2n[nH]c3c2CN([C@H]2NCCN4C=CCC24)C3(C)C)n1 |
| InChI | InChI=1S/C20H27FN8O/c1-4-30-19-23-10-13(21)17(25-19)24-16-12-11-29(20(2,3)15(12)26-27-16)18-14-6-5-8-28(14)9-7-22-18/h5,8,10,14,18,22H,4,6-7,9,11H2,1-3H3,(H2,23,24,25,26,27)/t14?,18-/m1/s1 |
| InChIKey | MRNUFXWZNWGJNI-XPKAQORNSA-N |
| XLogP | 2.05 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |