C13H15FN2O3S — CID 123492613
3-(4-fluorophenyl)sulfonyl-6-methyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 123492613) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-6-methyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-6-methyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 123492613 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-6-methyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1C2CN(S(=O)(=O)c3ccc(F)cc3)C(C(N)=O)C12 |
| InChI | InChI=1S/C13H15FN2O3S/c1-7-10-6-16(12(11(7)10)13(15)17)20(18,19)9-4-2-8(14)3-5-9/h2-5,7,10-12H,6H2,1H3,(H2,15,17) |
| InChIKey | MXJOLFKENJVDAG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |