C11H16N2 — CID 123495116
N-(3,5,6-trimethyl-2,3-dihydropyridin-4-yl)prop-2-en-1-imine (PubChem CID 123495116) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(3,5,6-trimethyl-2,3-dihydropyridin-4-yl)prop-2-en-1-imine.
| Compound Name | N-(3,5,6-trimethyl-2,3-dihydropyridin-4-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 123495116 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(3,5,6-trimethyl-2,3-dihydropyridin-4-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C1=C(C)C(C)=NCC1C |
| InChI | InChI=1S/C11H16N2/c1-5-6-12-11-8(2)7-13-10(4)9(11)3/h5-6,8H,1,7H2,2-4H3/b12-6+ |
| InChIKey | AXIWTWVWKUFGPH-WUXMJOGZSA-N |
| XLogP | 2.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|