C10H13ClN4 — CID 123499429
N-amino-2-chloro-3-imino-N'-(2-methylphenyl)propanimidamide (PubChem CID 123499429) has the molecular formula C10H13ClN4 and a molecular weight of 224.70 g/mol. Its IUPAC name is N-amino-2-chloro-3-imino-N'-(2-methylphenyl)propanimidamide.
| Compound Name | N-amino-2-chloro-3-imino-N'-(2-methylphenyl)propanimidamide |
|---|---|
| PubChem CID | 123499429 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.70 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-amino-2-chloro-3-imino-N'-(2-methylphenyl)propanimidamide |
| SMILES | [H]/N=C/C(Cl)/C(=N/c1ccccc1C)NN |
| InChI | InChI=1S/C10H13ClN4/c1-7-4-2-3-5-9(7)14-10(15-13)8(11)6-12/h2-6,8,12H,13H2,1H3,(H,14,15)/b12-6+ |
| InChIKey | XZGBTPPVIGZAPE-WUXMJOGZSA-N |
| XLogP | 1.75 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|