C16H23N3O — CID 137037339
N-[C-(2-imino-3,3-dimethylbutyl)-N-(2-methylphenyl)carbonimidoyl]acetamide (PubChem CID 137037339) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[C-(2-imino-3,3-dimethylbutyl)-N-(2-methylphenyl)carbonimidoyl]acetamide.
| Compound Name | N-[C-(2-imino-3,3-dimethylbutyl)-N-(2-methylphenyl)carbonimidoyl]acetamide |
|---|---|
| PubChem CID | 137037339 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[C-(2-imino-3,3-dimethylbutyl)-N-(2-methylphenyl)carbonimidoyl]acetamide |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1C)NC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C16H23N3O/c1-11-8-6-7-9-13(11)19-15(18-12(2)20)10-14(17)16(3,4)5/h6-9,17H,10H2,1-5H3,(H,18,19,20)/b17-14- |
| InChIKey | DXJZNQLMTAWGIY-VKAVYKQESA-N |
| XLogP | 3.62 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|