C26H21F3O2 — CID 123500089
2-fluoro-1-(5-fluorohexa-1,3,5-trien-2-yl)-4-[[3-fluoro-4-(4-methylphenyl)phenoxy]methoxy]benzene (PubChem CID 123500089) has the molecular formula C26H21F3O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-fluoro-1-(5-fluorohexa-1,3,5-trien-2-yl)-4-[[3-fluoro-4-(4-methylphenyl)phenoxy]methoxy]benzene.
| Compound Name | 2-fluoro-1-(5-fluorohexa-1,3,5-trien-2-yl)-4-[[3-fluoro-4-(4-methylphenyl)phenoxy]methoxy]benzene |
|---|---|
| PubChem CID | 123500089 |
| Molecular Formula | C26H21F3O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-fluoro-1-(5-fluorohexa-1,3,5-trien-2-yl)-4-[[3-fluoro-4-(4-methylphenyl)phenoxy]methoxy]benzene |
| SMILES | C=C(F)C=CC(=C)c1ccc(OCOc2ccc(-c3ccc(C)cc3)c(F)c2)cc1F |
| InChI | InChI=1S/C26H21F3O2/c1-17-4-8-20(9-5-17)24-13-11-22(15-26(24)29)31-16-30-21-10-12-23(25(28)14-21)18(2)6-7-19(3)27/h4-15H,2-3,16H2,1H3 |
| InChIKey | ZSXOIFUJYRNLQJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|