C9H15NO — CID 123502291
3-amino-1-cyclohexa-2,4-dien-1-ylpropan-1-ol (PubChem CID 123502291) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-amino-1-cyclohexa-2,4-dien-1-ylpropan-1-ol.
| Compound Name | 3-amino-1-cyclohexa-2,4-dien-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 123502291 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 3-amino-1-cyclohexa-2,4-dien-1-ylpropan-1-ol |
| SMILES | NCCC(O)C1C=CC=CC1 |
| InChI | InChI=1S/C9H15NO/c10-7-6-9(11)8-4-2-1-3-5-8/h1-4,8-9,11H,5-7,10H2 |
| InChIKey | OPBSKESEVPFGBZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |