C13H16N6O — CID 123507324
4-[4-(cyclopropylamino)-2-methylpyrazolo[1,5-a][1,3,5]triazin-8-yl]-3-iminobutan-2-one (PubChem CID 123507324) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[4-(cyclopropylamino)-2-methylpyrazolo[1,5-a][1,3,5]triazin-8-yl]-3-iminobutan-2-one.
| Compound Name | 4-[4-(cyclopropylamino)-2-methylpyrazolo[1,5-a][1,3,5]triazin-8-yl]-3-iminobutan-2-one |
|---|---|
| PubChem CID | 123507324 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-[4-(cyclopropylamino)-2-methylpyrazolo[1,5-a][1,3,5]triazin-8-yl]-3-iminobutan-2-one |
| SMILES | [H]/N=C(/Cc1cnn2c(NC3CC3)nc(C)nc12)C(C)=O |
| InChI | InChI=1S/C13H16N6O/c1-7(20)11(14)5-9-6-15-19-12(9)16-8(2)17-13(19)18-10-3-4-10/h6,10,14H,3-5H2,1-2H3,(H,16,17,18)/b14-11- |
| InChIKey | GCRHLEHOEMYBAJ-KAMYIIQDSA-N |
| XLogP | 1.16 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|