C18H30N6O — CID 91227014
N,N-diethyl-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide (PubChem CID 91227014) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is N,N-diethyl-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide.
| Compound Name | N,N-diethyl-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide |
|---|---|
| PubChem CID | 91227014 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | N,N-diethyl-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptanamide |
| SMILES | CCN(CC)C(=O)CCCCCCc1cnn2c(NC)nc(C)nc12 |
| InChI | InChI=1S/C18H30N6O/c1-5-23(6-2)16(25)12-10-8-7-9-11-15-13-20-24-17(15)21-14(3)22-18(24)19-4/h13H,5-12H2,1-4H3,(H,19,21,22) |
| InChIKey | ZOOFPZGOGNOJHF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|