C23H29NO2 — CID 123509210
(2,6-dibutyl-9H-fluoren-9-yl)-methylcarbamic acid (PubChem CID 123509210) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2,6-dibutyl-9H-fluoren-9-yl)-methylcarbamic acid.
| Compound Name | (2,6-dibutyl-9H-fluoren-9-yl)-methylcarbamic acid |
|---|---|
| PubChem CID | 123509210 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2,6-dibutyl-9H-fluoren-9-yl)-methylcarbamic acid |
| SMILES | CCCCc1ccc2c(c1)-c1ccc(CCCC)cc1C2N(C)C(=O)O |
| InChI | InChI=1S/C23H29NO2/c1-4-6-8-16-11-13-19-20(14-16)18-12-10-17(9-7-5-2)15-21(18)22(19)24(3)23(25)26/h10-15,22H,4-9H2,1-3H3,(H,25,26) |
| InChIKey | CSZPIJVPHREDGF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |