C31H52N2O6 — CID 123509998
3,5-bis[[1-(hexylamino)-1-oxohexan-2-yl]oxy]benzoic acid (PubChem CID 123509998) has the molecular formula C31H52N2O6 and a molecular weight of 548.77 g/mol. Its IUPAC name is 3,5-bis[[1-(hexylamino)-1-oxohexan-2-yl]oxy]benzoic acid.
| Compound Name | 3,5-bis[[1-(hexylamino)-1-oxohexan-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 123509998 |
| Molecular Formula | C31H52N2O6 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | 3,5-bis[[1-(hexylamino)-1-oxohexan-2-yl]oxy]benzoic acid |
| SMILES | CCCCCCNC(=O)C(CCCC)Oc1cc(OC(CCCC)C(=O)NCCCCCC)cc(C(=O)O)c1 |
| InChI | InChI=1S/C31H52N2O6/c1-5-9-13-15-19-32-29(34)27(17-11-7-3)38-25-21-24(31(36)37)22-26(23-25)39-28(18-12-8-4)30(35)33-20-16-14-10-6-2/h21-23,27-28H,5-20H2,1-4H3,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | JGDQETZCXGBMJC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|