C22H14FN5O — CID 123511488
2-(2-fluoro-4-pyridinyl)spiro[imidazo[1,2-c]imidazole-7,9'-xanthene]-5-amine (PubChem CID 123511488) has the molecular formula C22H14FN5O and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-(2-fluoro-4-pyridinyl)spiro[imidazo[1,2-c]imidazole-7,9'-xanthene]-5-amine.
| Compound Name | 2-(2-fluoro-4-pyridinyl)spiro[imidazo[1,2-c]imidazole-7,9'-xanthene]-5-amine |
|---|---|
| PubChem CID | 123511488 |
| Molecular Formula | C22H14FN5O |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-(2-fluoro-4-pyridinyl)spiro[imidazo[1,2-c]imidazole-7,9'-xanthene]-5-amine |
| SMILES | NC1=NC2(c3ccccc3Oc3ccccc32)c2nc(-c3ccnc(F)c3)cn21 |
| InChI | InChI=1S/C22H14FN5O/c23-19-11-13(9-10-25-19)16-12-28-20(26-16)22(27-21(28)24)14-5-1-3-7-17(14)29-18-8-4-2-6-15(18)22/h1-12H,(H2,24,27) |
| InChIKey | LRAPTWFBQJIQPQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|