C26H23ClFN2O2S+ — CID 123511822
N-[3-(3-chloro-4-fluorophenoxy)-4-(2-methylazet-1-ium-1-yl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide (PubChem CID 123511822) has the molecular formula C26H23ClFN2O2S+ and a molecular weight of 482.00 g/mol. Its IUPAC name is N-[3-(3-chloro-4-fluorophenoxy)-4-(2-methylazet-1-ium-1-yl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide.
| Compound Name | N-[3-(3-chloro-4-fluorophenoxy)-4-(2-methylazet-1-ium-1-yl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 123511822 |
| Molecular Formula | C26H23ClFN2O2S+ |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[3-(3-chloro-4-fluorophenoxy)-4-(2-methylazet-1-ium-1-yl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc([N+]3=C(C)C=C3)c(Oc3ccc(F)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C26H22ClFN2O2S/c1-3-33-21-8-4-18(5-9-21)14-26(31)29-19-6-11-24(30-13-12-17(30)2)25(15-19)32-20-7-10-23(28)22(27)16-20/h4-13,15-16H,3,14H2,1-2H3/p+1 |
| InChIKey | FJJQHGHRAGPDRJ-UHFFFAOYSA-O |
| XLogP | 7.20 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|