C18H18F4N2OSi — CID 123512563
2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-methyl-2-pyridinyl)-2-trimethylsilyloxypropanenitrile (PubChem CID 123512563) has the molecular formula C18H18F4N2OSi and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-methyl-2-pyridinyl)-2-trimethylsilyloxypropanenitrile.
| Compound Name | 2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-methyl-2-pyridinyl)-2-trimethylsilyloxypropanenitrile |
|---|---|
| PubChem CID | 123512563 |
| Molecular Formula | C18H18F4N2OSi |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3,3-difluoro-3-(5-methyl-2-pyridinyl)-2-trimethylsilyloxypropanenitrile |
| SMILES | Cc1ccc(C(F)(F)C(C#N)(O[Si](C)(C)C)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C18H18F4N2OSi/c1-12-5-8-16(24-10-12)18(21,22)17(11-23,25-26(2,3)4)14-7-6-13(19)9-15(14)20/h5-10H,1-4H3 |
| InChIKey | ROYITAOFOFQDNA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|