C32H49N3O5 — CID 123513393
tert-butyl 6-[2-[ethenyl-[1-[2-(2-hydroxypropan-2-yl)phenyl]ethyl]amino]hept-2-enoyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate (PubChem CID 123513393) has the molecular formula C32H49N3O5 and a molecular weight of 555.76 g/mol. Its IUPAC name is tert-butyl 6-[2-[ethenyl-[1-[2-(2-hydroxypropan-2-yl)phenyl]ethyl]amino]hept-2-enoyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate.
| Compound Name | tert-butyl 6-[2-[ethenyl-[1-[2-(2-hydroxypropan-2-yl)phenyl]ethyl]amino]hept-2-enoyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 123513393 |
| Molecular Formula | C32H49N3O5 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.37 |
| IUPAC Name | tert-butyl 6-[2-[ethenyl-[1-[2-(2-hydroxypropan-2-yl)phenyl]ethyl]amino]hept-2-enoyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrido[3,4-b][1,4]oxazine-1-carboxylate |
| SMILES | C=CN(C(=CCCCC)C(=O)N1CCC2C(C1)OCCN2C(=O)OC(C)(C)C)C(C)c1ccccc1C(C)(C)O |
| InChI | InChI=1S/C32H49N3O5/c1-9-11-12-17-27(34(10-2)23(3)24-15-13-14-16-25(24)32(7,8)38)29(36)33-19-18-26-28(22-33)39-21-20-35(26)30(37)40-31(4,5)6/h10,13-17,23,26,28,38H,2,9,11-12,18-22H2,1,3-8H3 |
| InChIKey | NSTXGGFPLLFWCM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|