C19H29N3O5 — CID 123514578
2-[2-hydroxyethyl-[2-[(6-imino-6-phenylmethoxyhexyl)amino]-2-oxoethyl]amino]acetic acid (PubChem CID 123514578) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[2-[(6-imino-6-phenylmethoxyhexyl)amino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[2-hydroxyethyl-[2-[(6-imino-6-phenylmethoxyhexyl)amino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 123514578 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[2-hydroxyethyl-[2-[(6-imino-6-phenylmethoxyhexyl)amino]-2-oxoethyl]amino]acetic acid |
| SMILES | [H]/N=C(\CCCCCNC(=O)CN(CCO)CC(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29N3O5/c20-17(27-15-16-7-3-1-4-8-16)9-5-2-6-10-21-18(24)13-22(11-12-23)14-19(25)26/h1,3-4,7-8,20,23H,2,5-6,9-15H2,(H,21,24)(H,25,26)/b20-17+ |
| InChIKey | SMHLWRGVVNJXPL-LVZFUZTISA-N |
| XLogP | 1.24 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|