C16H24N2O5 — CID 90257362
2-[(6-hydroxyhexylamino)-phenylmethoxycarbonylamino]acetic acid (PubChem CID 90257362) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(6-hydroxyhexylamino)-phenylmethoxycarbonylamino]acetic acid.
| Compound Name | 2-[(6-hydroxyhexylamino)-phenylmethoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 90257362 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[(6-hydroxyhexylamino)-phenylmethoxycarbonylamino]acetic acid |
| SMILES | O=C(O)CN(NCCCCCCO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H24N2O5/c19-11-7-2-1-6-10-17-18(12-15(20)21)16(22)23-13-14-8-4-3-5-9-14/h3-5,8-9,17,19H,1-2,6-7,10-13H2,(H,20,21) |
| InChIKey | ZZXKNJIZGMEGPN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|