C37H33F6N3S3 — CID 123515100
7-[5-(9-hexyl-4,7-dimethyl-3,4-dihydrocarbazol-2-yl)thiophen-2-yl]-4-[5-methyl-3,4-bis(trifluoromethyl)thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 123515100) has the molecular formula C37H33F6N3S3 and a molecular weight of 729.88 g/mol. Its IUPAC name is 7-[5-(9-hexyl-4,7-dimethyl-3,4-dihydrocarbazol-2-yl)thiophen-2-yl]-4-[5-methyl-3,4-bis(trifluoromethyl)thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 7-[5-(9-hexyl-4,7-dimethyl-3,4-dihydrocarbazol-2-yl)thiophen-2-yl]-4-[5-methyl-3,4-bis(trifluoromethyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 123515100 |
| Molecular Formula | C37H33F6N3S3 |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 729.17 |
| IUPAC Name | 7-[5-(9-hexyl-4,7-dimethyl-3,4-dihydrocarbazol-2-yl)thiophen-2-yl]-4-[5-methyl-3,4-bis(trifluoromethyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCn1c2c(c3ccc(C)cc31)C(C)CC(c1ccc(-c3ccc(-c4sc(C)c(C(F)(F)F)c4C(F)(F)F)c4nsnc34)s1)=C2 |
| InChI | InChI=1S/C37H33F6N3S3/c1-5-6-7-8-15-46-26-16-19(2)9-10-23(26)30-20(3)17-22(18-27(30)46)28-13-14-29(48-28)24-11-12-25(34-33(24)44-49-45-34)35-32(37(41,42)43)31(21(4)47-35)36(38,39)40/h9-14,16,18,20H,5-8,15,17H2,1-4H3 |
| InChIKey | AOEVDCLMVDTHEN-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|