C15H21N — CID 123519696
(7E)-4-methyl-N-prop-2-enylundeca-1,4,7,9-tetraen-3-imine (PubChem CID 123519696) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (7E)-4-methyl-N-prop-2-enylundeca-1,4,7,9-tetraen-3-imine.
| Compound Name | (7E)-4-methyl-N-prop-2-enylundeca-1,4,7,9-tetraen-3-imine |
|---|---|
| PubChem CID | 123519696 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (7E)-4-methyl-N-prop-2-enylundeca-1,4,7,9-tetraen-3-imine |
| SMILES | C=CC/N=C(\C=C)C(C)=CC/C=C/C=CC |
| InChI | InChI=1S/C15H21N/c1-5-8-9-10-11-12-14(4)15(7-3)16-13-6-2/h5-10,12H,2-3,11,13H2,1,4H3/b8-5?,10-9+,14-12?,16-15+ |
| InChIKey | DLKJOPDKCNUAHI-VKOKGVQHSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|