C8H12N2O — CID 123522269
2-amino-N-hexa-1,3,5-trien-3-ylacetamide (PubChem CID 123522269) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-amino-N-hexa-1,3,5-trien-3-ylacetamide.
| Compound Name | 2-amino-N-hexa-1,3,5-trien-3-ylacetamide |
|---|---|
| PubChem CID | 123522269 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-amino-N-hexa-1,3,5-trien-3-ylacetamide |
| SMILES | C=CC=C(C=C)NC(=O)CN |
| InChI | InChI=1S/C8H12N2O/c1-3-5-7(4-2)10-8(11)6-9/h3-5H,1-2,6,9H2,(H,10,11) |
| InChIKey | XNGQNYKYJDFZCX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|