C12H19FN2O — CID 142402250
2-(2-fluoroethylamino)-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]acetamide (PubChem CID 142402250) has the molecular formula C12H19FN2O and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(2-fluoroethylamino)-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]acetamide.
| Compound Name | 2-(2-fluoroethylamino)-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 142402250 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-(2-fluoroethylamino)-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]acetamide |
| SMILES | C/C=C\C=C/C(=C\C)NC(=O)CNCCF |
| InChI | InChI=1S/C12H19FN2O/c1-3-5-6-7-11(4-2)15-12(16)10-14-9-8-13/h3-7,14H,8-10H2,1-2H3,(H,15,16)/b5-3-,7-6-,11-4+ |
| InChIKey | XSNDPBPIDKPXBC-MAZQSRLXSA-N |
| XLogP | 1.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|