C14H22F2N2O — CID 143530016
N-[2-[[(2Z,4Z,6E)-5,7-difluoroocta-2,4,6-trien-4-yl]amino]ethyl]-N-ethylacetamide (PubChem CID 143530016) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is N-[2-[[(2Z,4Z,6E)-5,7-difluoroocta-2,4,6-trien-4-yl]amino]ethyl]-N-ethylacetamide.
| Compound Name | N-[2-[[(2Z,4Z,6E)-5,7-difluoroocta-2,4,6-trien-4-yl]amino]ethyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 143530016 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-[2-[[(2Z,4Z,6E)-5,7-difluoroocta-2,4,6-trien-4-yl]amino]ethyl]-N-ethylacetamide |
| SMILES | C/C=C\C(NCCN(CC)C(C)=O)=C(F)/C=C(\C)F |
| InChI | InChI=1S/C14H22F2N2O/c1-5-7-14(13(16)10-11(3)15)17-8-9-18(6-2)12(4)19/h5,7,10,17H,6,8-9H2,1-4H3/b7-5-,11-10+,14-13- |
| InChIKey | WIKBAENWYMBGAC-ZLUPKWDLSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|