C9H12F3N3O2 — CID 171822303
N'-[(2E)-4-(2,2,2-trifluoroethylamino)penta-2,4-dienyl]oxamide (PubChem CID 171822303) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is N'-[(2E)-4-(2,2,2-trifluoroethylamino)penta-2,4-dienyl]oxamide.
| Compound Name | N'-[(2E)-4-(2,2,2-trifluoroethylamino)penta-2,4-dienyl]oxamide |
|---|---|
| PubChem CID | 171822303 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N'-[(2E)-4-(2,2,2-trifluoroethylamino)penta-2,4-dienyl]oxamide |
| SMILES | C=C(/C=C/CNC(=O)C(N)=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c1-6(15-5-9(10,11)12)3-2-4-14-8(17)7(13)16/h2-3,15H,1,4-5H2,(H2,13,16)(H,14,17)/b3-2+ |
| InChIKey | PNCAGYKHMWCBMU-NSCUHMNNSA-N |
| XLogP | -0.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|