C10H15N — CID 123525197
4-methylidene-1,2,3,6,7,9a-hexahydroquinolizine (PubChem CID 123525197) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-methylidene-1,2,3,6,7,9a-hexahydroquinolizine.
| Compound Name | 4-methylidene-1,2,3,6,7,9a-hexahydroquinolizine |
|---|---|
| PubChem CID | 123525197 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4-methylidene-1,2,3,6,7,9a-hexahydroquinolizine |
| SMILES | C=C1CCCC2C=CCCN12 |
| InChI | InChI=1S/C10H15N/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2,6,10H,1,3-5,7-8H2 |
| InChIKey | LOXXMKVDJNRGAJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|