About 1,2-bis(ethenyl)piperidine
1,2-bis(ethenyl)piperidine (PubChem CID 22465139) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1,2-bis(ethenyl)piperidine.
Molecular Properties
| Compound Name | 1,2-bis(ethenyl)piperidine |
| PubChem CID | 22465139 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1,2-bis(ethenyl)piperidine |
| SMILES | C=CC1CCCCN1C=C |
| InChI | InChI=1S/C9H15N/c1-3-9-7-5-6-8-10(9)4-2/h3-4,9H,1-2,5-8H2 |
| InChIKey | GXOMJTUKGGNEMI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(ethenyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenyl)piperidine?
The IUPAC name of 1,2-bis(ethenyl)piperidine (CID 22465139) is 1,2-bis(ethenyl)piperidine.
What is the SMILES notation for 1,2-bis(ethenyl)piperidine?
The canonical SMILES for 1,2-bis(ethenyl)piperidine is C=CC1CCCCN1C=C.
What is the InChIKey of 1,2-bis(ethenyl)piperidine?
The InChIKey is GXOMJTUKGGNEMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-9-7-5-6-8-10(9)4-2/h3-4,9H,1-2,5-8H2.
What are the key properties of 1,2-bis(ethenyl)piperidine?
1,2-bis(ethenyl)piperidine has a molecular weight of 137.23 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenyl)piperidine is sourced from PubChem (CID 22465139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).