C28H27F3N4O3S — CID 123525218
3-[2-(3-ethenylpyrrolidin-1-yl)ethyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123525218) has the molecular formula C28H27F3N4O3S and a molecular weight of 556.61 g/mol. Its IUPAC name is 3-[2-(3-ethenylpyrrolidin-1-yl)ethyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-(3-ethenylpyrrolidin-1-yl)ethyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123525218 |
| Molecular Formula | C28H27F3N4O3S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3-[2-(3-ethenylpyrrolidin-1-yl)ethyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CC1CCN(CCN2C(=O)SC(=Cc3ccc4c(cnn4Cc4ccc(OC)cc4C(F)(F)F)c3)C2=O)C1 |
| InChI | InChI=1S/C28H27F3N4O3S/c1-3-18-8-9-33(16-18)10-11-34-26(36)25(39-27(34)37)13-19-4-7-24-21(12-19)15-32-35(24)17-20-5-6-22(38-2)14-23(20)28(29,30)31/h3-7,12-15,18H,1,8-11,16-17H2,2H3 |
| InChIKey | ZGHJXAWLJRCUJM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|