C25H25F3N4O3S — CID 76814537
3-[3-(dimethylamino)propyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76814537) has the molecular formula C25H25F3N4O3S and a molecular weight of 518.56 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-(dimethylamino)propyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814537 |
| Molecular Formula | C25H25F3N4O3S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Cn2ncc3cc(C=C4SC(=O)N(CCCN(C)C)C4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H25F3N4O3S/c1-30(2)9-4-10-31-23(33)22(36-24(31)34)12-16-5-8-21-18(11-16)14-29-32(21)15-17-6-7-19(35-3)13-20(17)25(26,27)28/h5-8,11-14H,4,9-10,15H2,1-3H3 |
| InChIKey | OFGIWZOVPMWKIZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|