C21H16ClF3N4O2S — CID 76774444
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methoxy(methyl)amino]-1,3-thiazol-4-one (PubChem CID 76774444) has the molecular formula C21H16ClF3N4O2S and a molecular weight of 480.90 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methoxy(methyl)amino]-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methoxy(methyl)amino]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76774444 |
| Molecular Formula | C21H16ClF3N4O2S |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[methoxy(methyl)amino]-1,3-thiazol-4-one |
| SMILES | CON(C)C1=NC(=O)C(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C21H16ClF3N4O2S/c1-28(31-2)20-27-19(30)18(32-20)8-12-3-6-17-14(7-12)10-26-29(17)11-13-4-5-15(22)9-16(13)21(23,24)25/h3-10H,11H2,1-2H3 |
| InChIKey | GHWRQFGETIXODL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|