C21H15ClF3N3OS2 — CID 67240123
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-4-one (PubChem CID 67240123) has the molecular formula C21H15ClF3N3OS2 and a molecular weight of 481.95 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67240123 |
| Molecular Formula | C21H15ClF3N3OS2 |
| Molecular Weight | 481.95 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-ethylsulfanyl-1,3-thiazol-4-one |
| SMILES | CCSC1=NC(=O)C(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C21H15ClF3N3OS2/c1-2-30-20-27-19(29)18(31-20)8-12-3-6-17-14(7-12)10-26-28(17)11-13-4-5-15(22)9-16(13)21(23,24)25/h3-10H,2,11H2,1H3 |
| InChIKey | QSPZDGDOCAZMDI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.95 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|